C24H40N12O4P2 — CID 90869359
6-N-cyclopropyl-9-[2-(dimethylphosphorylmethoxy)ethyl]purine-2,6-diamine;9-[2-(dimethylphosphorylmethoxy)ethyl]-6-N-methylpurine-2,6-diamine (PubChem CID 90869359) has the molecular formula C24H40N12O4P2 and a molecular weight of 622.61 g/mol. Its IUPAC name is 6-N-cyclopropyl-9-[2-(dimethylphosphorylmethoxy)ethyl]purine-2,6-diamine;9-[2-(dimethylphosphorylmethoxy)ethyl]-6-N-methylpurine-2,6-diamine.
| Compound Name | 6-N-cyclopropyl-9-[2-(dimethylphosphorylmethoxy)ethyl]purine-2,6-diamine;9-[2-(dimethylphosphorylmethoxy)ethyl]-6-N-methylpurine-2,6-diamine |
|---|---|
| PubChem CID | 90869359 |
| Molecular Formula | C24H40N12O4P2 |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 6-N-cyclopropyl-9-[2-(dimethylphosphorylmethoxy)ethyl]purine-2,6-diamine;9-[2-(dimethylphosphorylmethoxy)ethyl]-6-N-methylpurine-2,6-diamine |
| SMILES | CNc1nc(N)nc2c1ncn2CCOCP(C)(C)=O.CP(C)(=O)COCCn1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C13H21N6O2P.C11H19N6O2P/c1-22(2,20)8-21-6-5-19-7-15-10-11(16-9-3-4-9)17-13(14)18-12(10)19;1-13-9-8-10(16-11(12)15-9)17(6-14-8)4-5-19-7-20(2,3)18/h7,9H,3-6,8H2,1-2H3,(H3,14,16,17,18);6H,4-5,7H2,1-3H3,(H3,12,13,15,16) |
| InChIKey | ABWWMOJUQJIFFY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 215.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|