C13H19N6O4P — CID 70147461
[(2R,5R)-5-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]oxolan-2-yl]phosphonic acid (PubChem CID 70147461) has the molecular formula C13H19N6O4P and a molecular weight of 354.31 g/mol. Its IUPAC name is [(2R,5R)-5-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]oxolan-2-yl]phosphonic acid.
| Compound Name | [(2R,5R)-5-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]oxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 70147461 |
| Molecular Formula | C13H19N6O4P |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [(2R,5R)-5-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]oxolan-2-yl]phosphonic acid |
| SMILES | Nc1nc(NC2CC2)c2ncn(C[C@H]3CC[C@@H](P(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C13H19N6O4P/c14-13-17-11(16-7-1-2-7)10-12(18-13)19(6-15-10)5-8-3-4-9(23-8)24(20,21)22/h6-9H,1-5H2,(H2,20,21,22)(H3,14,16,17,18)/t8-,9-/m1/s1 |
| InChIKey | GUXXJGMYOVVLST-RKDXNWHRSA-N |
| XLogP | 0.67 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|