C14H18N5O4P — CID 10291546
[(2R,5R)-5-[(2-amino-6-cyclopropylpurin-9-yl)methyl]-4-methylideneoxolan-2-yl]phosphonic acid (PubChem CID 10291546) has the molecular formula C14H18N5O4P and a molecular weight of 351.30 g/mol. Its IUPAC name is [(2R,5R)-5-[(2-amino-6-cyclopropylpurin-9-yl)methyl]-4-methylideneoxolan-2-yl]phosphonic acid.
| Compound Name | [(2R,5R)-5-[(2-amino-6-cyclopropylpurin-9-yl)methyl]-4-methylideneoxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 10291546 |
| Molecular Formula | C14H18N5O4P |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(2R,5R)-5-[(2-amino-6-cyclopropylpurin-9-yl)methyl]-4-methylideneoxolan-2-yl]phosphonic acid |
| SMILES | C=C1C[C@@H](P(=O)(O)O)O[C@H]1Cn1cnc2c(C3CC3)nc(N)nc21 |
| InChI | InChI=1S/C14H18N5O4P/c1-7-4-10(24(20,21)22)23-9(7)5-19-6-16-12-11(8-2-3-8)17-14(15)18-13(12)19/h6,8-10H,1-5H2,(H2,15,17,18)(H2,20,21,22)/t9-,10+/m0/s1 |
| InChIKey | HKDDBPBREBIIAI-VHSXEESVSA-N |
| XLogP | 1.13 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|