C13H18BrN6O4P — CID 70148644
[(2R,4R,5R)-4-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]-5-bromooxolan-2-yl]phosphonic acid (PubChem CID 70148644) has the molecular formula C13H18BrN6O4P and a molecular weight of 433.20 g/mol. Its IUPAC name is [(2R,4R,5R)-4-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]-5-bromooxolan-2-yl]phosphonic acid.
| Compound Name | [(2R,4R,5R)-4-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]-5-bromooxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 70148644 |
| Molecular Formula | C13H18BrN6O4P |
| Molecular Weight | 433.20 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [(2R,4R,5R)-4-[[2-amino-6-(cyclopropylamino)purin-9-yl]methyl]-5-bromooxolan-2-yl]phosphonic acid |
| SMILES | Nc1nc(NC2CC2)c2ncn(C[C@H]3C[C@@H](P(=O)(O)O)O[C@@H]3Br)c2n1 |
| InChI | InChI=1S/C13H18BrN6O4P/c14-10-6(3-8(24-10)25(21,22)23)4-20-5-16-9-11(17-7-1-2-7)18-13(15)19-12(9)20/h5-8,10H,1-4H2,(H2,21,22,23)(H3,15,17,18,19)/t6-,8-,10+/m1/s1 |
| InChIKey | DIJIADXCDZPKMV-YNEQXMIYSA-N |
| XLogP | 1.24 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|