C14H23N6O7P — CID 90079247
[(2R,3R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]-3,4-dihydroxypentyl] dihydrogen phosphate (PubChem CID 90079247) has the molecular formula C14H23N6O7P and a molecular weight of 418.35 g/mol. Its IUPAC name is [(2R,3R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]-3,4-dihydroxypentyl] dihydrogen phosphate.
| Compound Name | [(2R,3R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]-3,4-dihydroxypentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90079247 |
| Molecular Formula | C14H23N6O7P |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [(2R,3R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]-3,4-dihydroxypentyl] dihydrogen phosphate |
| SMILES | CC(O)[C@@H](O)[C@@H](COP(=O)(O)O)OCn1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C14H23N6O7P/c1-7(21)11(22)9(4-27-28(23,24)25)26-6-20-5-16-10-12(17-8-2-3-8)18-14(15)19-13(10)20/h5,7-9,11,21-22H,2-4,6H2,1H3,(H2,23,24,25)(H3,15,17,18,19)/t7?,9-,11-/m1/s1 |
| InChIKey | UDMLRZWMBNGWNY-MOBVGWBASA-N |
| XLogP | -0.82 |
| TPSA | 198.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|