C13H22N7O3P — CID 143387019
9-[2-[[amino(ethoxy)phosphoryl]methoxy]ethyl]-6-N-prop-2-enylpurine-2,6-diamine (PubChem CID 143387019) has the molecular formula C13H22N7O3P and a molecular weight of 355.34 g/mol. Its IUPAC name is 9-[2-[[amino(ethoxy)phosphoryl]methoxy]ethyl]-6-N-prop-2-enylpurine-2,6-diamine.
| Compound Name | 9-[2-[[amino(ethoxy)phosphoryl]methoxy]ethyl]-6-N-prop-2-enylpurine-2,6-diamine |
|---|---|
| PubChem CID | 143387019 |
| Molecular Formula | C13H22N7O3P |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 9-[2-[[amino(ethoxy)phosphoryl]methoxy]ethyl]-6-N-prop-2-enylpurine-2,6-diamine |
| SMILES | C=CCNc1nc(N)nc2c1ncn2CCOCP(N)(=O)OCC |
| InChI | InChI=1S/C13H22N7O3P/c1-3-5-16-11-10-12(19-13(14)18-11)20(8-17-10)6-7-22-9-24(15,21)23-4-2/h3,8H,1,4-7,9H2,2H3,(H2,15,21)(H3,14,16,18,19) |
| InChIKey | QPFVVJXZUABTHB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|