C29H53N8O6P — CID 143387189
hexyl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-hexoxy-1-hydroxypropan-2-yl)amino]phosphoryl]amino]propanoate (PubChem CID 143387189) has the molecular formula C29H53N8O6P and a molecular weight of 640.77 g/mol. Its IUPAC name is hexyl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-hexoxy-1-hydroxypropan-2-yl)amino]phosphoryl]amino]propanoate.
| Compound Name | hexyl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-hexoxy-1-hydroxypropan-2-yl)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 143387189 |
| Molecular Formula | C29H53N8O6P |
| Molecular Weight | 640.77 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | hexyl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-hexoxy-1-hydroxypropan-2-yl)amino]phosphoryl]amino]propanoate |
| SMILES | C=CCNc1nc(N)nc2c1ncn2CCOCP(=O)(NC(C)C(=O)OCCCCCC)NC(C)C(O)OCCCCCC |
| InChI | InChI=1S/C29H53N8O6P/c1-6-9-11-13-17-42-27(38)22(4)35-44(40,36-23(5)28(39)43-18-14-12-10-7-2)21-41-19-16-37-20-32-24-25(31-15-8-3)33-29(30)34-26(24)37/h8,20,22-23,27,38H,3,6-7,9-19,21H2,1-2,4-5H3,(H2,35,36,40)(H3,30,31,33,34) |
| InChIKey | DGVOOLWCFFDUOK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 187.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|