C20H32N7O7P — CID 145045985
propan-2-yl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]but-3-enoate (PubChem CID 145045985) has the molecular formula C20H32N7O7P and a molecular weight of 513.49 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]but-3-enoate.
| Compound Name | propan-2-yl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]but-3-enoate |
|---|---|
| PubChem CID | 145045985 |
| Molecular Formula | C20H32N7O7P |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | propan-2-yl (2R)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]but-3-enoate |
| SMILES | C=C[C@@H](NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)N[C@@H](C)C(=O)OCC)C(=O)OC(C)C |
| InChI | InChI=1S/C20H32N7O7P/c1-6-14(19(30)34-12(3)4)26-35(31,25-13(5)18(29)33-7-2)11-32-9-8-27-10-22-15-16(27)23-20(21)24-17(15)28/h6,10,12-14H,1,7-9,11H2,2-5H3,(H2,25,26,31)(H3,21,23,24,28)/t13-,14+,35?/m0/s1 |
| InChIKey | AMICEZAINCVRDB-YUOSMYNRSA-N |
| XLogP | 0.51 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|