C24H43N8O6P — CID 159123861
methane;propan-2-yl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate (PubChem CID 159123861) has the molecular formula C24H43N8O6P and a molecular weight of 570.63 g/mol. Its IUPAC name is methane;propan-2-yl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate.
| Compound Name | methane;propan-2-yl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159123861 |
| Molecular Formula | C24H43N8O6P |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | methane;propan-2-yl 2-[[2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]amino]propanoate |
| SMILES | C.C=CCNc1nc(N)nc2c1ncn2CCOCP(=O)(NC(C)C(=O)OC(C)C)NC(C)C(=O)OC(C)C |
| InChI | InChI=1S/C23H39N8O6P.CH4/c1-8-9-25-19-18-20(28-23(24)27-19)31(12-26-18)10-11-35-13-38(34,29-16(6)21(32)36-14(2)3)30-17(7)22(33)37-15(4)5;/h8,12,14-17H,1,9-11,13H2,2-7H3,(H2,29,30,34)(H3,24,25,27,28);1H4 |
| InChIKey | KGAOVYDLJMGQGW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 184.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|