C20H39N6O4P — CID 143387020
2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-ethoxyphosphinic acid;2-methylpropane;propane (PubChem CID 143387020) has the molecular formula C20H39N6O4P and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-ethoxyphosphinic acid;2-methylpropane;propane.
| Compound Name | 2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-ethoxyphosphinic acid;2-methylpropane;propane |
|---|---|
| PubChem CID | 143387020 |
| Molecular Formula | C20H39N6O4P |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethyl-ethoxyphosphinic acid;2-methylpropane;propane |
| SMILES | C=CCNc1nc(N)nc2c1ncn2CCOCP(=O)(O)OCC.CC(C)C.CCC |
| InChI | InChI=1S/C13H21N6O4P.C4H10.C3H8/c1-3-5-15-11-10-12(18-13(14)17-11)19(8-16-10)6-7-22-9-24(20,21)23-4-2;1-4(2)3;1-3-2/h3,8H,1,4-7,9H2,2H3,(H,20,21)(H3,14,15,17,18);4H,1-3H3;3H2,1-2H3 |
| InChIKey | PJFJLEVBMXIAMZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|