C35H53N11O11P2 — CID 159087368
2-(2-amino-6-propoxypurin-9-yl)ethoxymethylphosphonic acid;butyl (2S)-2-[[2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 159087368) has the molecular formula C35H53N11O11P2 and a molecular weight of 865.82 g/mol. Its IUPAC name is 2-(2-amino-6-propoxypurin-9-yl)ethoxymethylphosphonic acid;butyl (2S)-2-[[2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-(2-amino-6-propoxypurin-9-yl)ethoxymethylphosphonic acid;butyl (2S)-2-[[2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159087368 |
| Molecular Formula | C35H53N11O11P2 |
| Molecular Weight | 865.82 g/mol |
| Exact Mass | 865.34 |
| IUPAC Name | 2-(2-amino-6-propoxypurin-9-yl)ethoxymethylphosphonic acid;butyl (2S)-2-[[2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(COCCn1cnc2c(OCCC)nc(N)nc21)Oc1ccccc1.CCCOc1nc(N)nc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C24H35N6O6P.C11H18N5O5P/c1-4-6-14-35-23(31)18(3)29-37(32,36-19-10-8-7-9-11-19)17-33-15-12-30-16-26-20-21(30)27-24(25)28-22(20)34-13-5-2;1-2-4-21-10-8-9(14-11(12)15-10)16(6-13-8)3-5-20-7-22(17,18)19/h7-11,16,18H,4-6,12-15,17H2,1-3H3,(H,29,32)(H2,25,27,28);6H,2-5,7H2,1H3,(H2,12,14,15)(H2,17,18,19)/t18-,37?;/m0./s1 |
| InChIKey | KBPNAFQNHDGKIW-IWHJNVDYSA-N |
| XLogP | 4.11 |
| TPSA | 298.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|