C12H20N7O4P — CID 10861234
2-(2-amino-6-piperazin-1-ylpurin-9-yl)ethoxymethylphosphonic acid (PubChem CID 10861234) has the molecular formula C12H20N7O4P and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-(2-amino-6-piperazin-1-ylpurin-9-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(2-amino-6-piperazin-1-ylpurin-9-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 10861234 |
| Molecular Formula | C12H20N7O4P |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(2-amino-6-piperazin-1-ylpurin-9-yl)ethoxymethylphosphonic acid |
| SMILES | Nc1nc(N2CCNCC2)c2ncn(CCOCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C12H20N7O4P/c13-12-16-10(18-3-1-14-2-4-18)9-11(17-12)19(7-15-9)5-6-23-8-24(20,21)22/h7,14H,1-6,8H2,(H2,13,16,17)(H2,20,21,22) |
| InChIKey | FYRVOGXWPKLOCY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|