C14H21N6O5P — CID 10178040
[1-[(2-amino-6-morpholin-4-ylpurin-9-yl)methyl]cyclopropyl]oxymethylphosphonic acid (PubChem CID 10178040) has the molecular formula C14H21N6O5P and a molecular weight of 384.33 g/mol. Its IUPAC name is [1-[(2-amino-6-morpholin-4-ylpurin-9-yl)methyl]cyclopropyl]oxymethylphosphonic acid.
| Compound Name | [1-[(2-amino-6-morpholin-4-ylpurin-9-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 10178040 |
| Molecular Formula | C14H21N6O5P |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [1-[(2-amino-6-morpholin-4-ylpurin-9-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
| SMILES | Nc1nc(N2CCOCC2)c2ncn(CC3(OCP(=O)(O)O)CC3)c2n1 |
| InChI | InChI=1S/C14H21N6O5P/c15-13-17-11(19-3-5-24-6-4-19)10-12(18-13)20(8-16-10)7-14(1-2-14)25-9-26(21,22)23/h8H,1-7,9H2,(H2,15,17,18)(H2,21,22,23) |
| InChIKey | FTDWAAKZFYYPKW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|