C26H38N12O5P+ — CID 68980854
bis[[1-[[2-amino-6-(propan-2-ylamino)purin-9-yl]methyl]cyclopropyl]oxymethoxy]-oxophosphanium (PubChem CID 68980854) has the molecular formula C26H38N12O5P+ and a molecular weight of 629.64 g/mol. Its IUPAC name is bis[[1-[[2-amino-6-(propan-2-ylamino)purin-9-yl]methyl]cyclopropyl]oxymethoxy]-oxophosphanium.
| Compound Name | bis[[1-[[2-amino-6-(propan-2-ylamino)purin-9-yl]methyl]cyclopropyl]oxymethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 68980854 |
| Molecular Formula | C26H38N12O5P+ |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | bis[[1-[[2-amino-6-(propan-2-ylamino)purin-9-yl]methyl]cyclopropyl]oxymethoxy]-oxophosphanium |
| SMILES | CC(C)Nc1nc(N)nc2c1ncn2CC1(OCO[P+](=O)OCOC2(Cn3cnc4c(NC(C)C)nc(N)nc43)CC2)CC1 |
| InChI | InChI=1S/C26H38N12O5P/c1-15(2)31-19-17-21(35-23(27)33-19)37(11-29-17)9-25(5-6-25)40-13-42-44(39)43-14-41-26(7-8-26)10-38-12-30-18-20(32-16(3)4)34-24(28)36-22(18)38/h11-12,15-16H,5-10,13-14H2,1-4H3,(H3,27,31,33,35)(H3,28,32,34,36)/q+1 |
| InChIKey | IJZYMXSCWFNTAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 217.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|