C16H26N5O4P — CID 58777433
9-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]purin-6-amine (PubChem CID 58777433) has the molecular formula C16H26N5O4P and a molecular weight of 383.39 g/mol. Its IUPAC name is 9-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]purin-6-amine.
| Compound Name | 9-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 58777433 |
| Molecular Formula | C16H26N5O4P |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 9-[[1-[di(propan-2-yloxy)phosphorylmethoxy]cyclopropyl]methyl]purin-6-amine |
| SMILES | CC(C)OP(=O)(COC1(Cn2cnc3c(N)ncnc32)CC1)OC(C)C |
| InChI | InChI=1S/C16H26N5O4P/c1-11(2)24-26(22,25-12(3)4)10-23-16(5-6-16)7-21-9-20-13-14(17)18-8-19-15(13)21/h8-9,11-12H,5-7,10H2,1-4H3,(H2,17,18,19) |
| InChIKey | HUFJTORDOSJVSO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|