C16H25N6O6P — CID 148548920
[[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]-methylamino]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 148548920) has the molecular formula C16H25N6O6P and a molecular weight of 428.39 g/mol. Its IUPAC name is [[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]-methylamino]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]-methylamino]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 148548920 |
| Molecular Formula | C16H25N6O6P |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]-methylamino]methyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)CN(C)C1(Cn2cnc3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C16H25N6O6P/c1-11(2)28-15(23)26-10-27-29(24,25)9-21(3)16(4-5-16)6-22-8-20-12-13(17)18-7-19-14(12)22/h7-8,11H,4-6,9-10H2,1-3H3,(H,24,25)(H2,17,18,19) |
| InChIKey | XSLRBJUUXTVDCU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|