C18H25N5O6 — CID 123767748
[3-[2-[1-(6-aminopurin-9-yl)propan-2-yloxy]ethyl]-2-oxabicyclo[1.1.0]butan-1-yl]oxymethyl propan-2-yl carbonate (PubChem CID 123767748) has the molecular formula C18H25N5O6 and a molecular weight of 407.43 g/mol. Its IUPAC name is [3-[2-[1-(6-aminopurin-9-yl)propan-2-yloxy]ethyl]-2-oxabicyclo[1.1.0]butan-1-yl]oxymethyl propan-2-yl carbonate.
| Compound Name | [3-[2-[1-(6-aminopurin-9-yl)propan-2-yloxy]ethyl]-2-oxabicyclo[1.1.0]butan-1-yl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 123767748 |
| Molecular Formula | C18H25N5O6 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [3-[2-[1-(6-aminopurin-9-yl)propan-2-yloxy]ethyl]-2-oxabicyclo[1.1.0]butan-1-yl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOC12CC1(CCOC(C)Cn1cnc3c(N)ncnc31)O2 |
| InChI | InChI=1S/C18H25N5O6/c1-11(2)28-16(24)26-10-27-18-7-17(18,29-18)4-5-25-12(3)6-23-9-22-13-14(19)20-8-21-15(13)23/h8-9,11-12H,4-7,10H2,1-3H3,(H2,19,20,21) |
| InChIKey | XZIAQVVPPRJXAJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 136.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|