C20H31N5O10P+ — CID 163875827
[2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-(propan-2-yloxycarbonyloxymethoxy)oxaphosphiran-2-ium-3-yl]oxymethyl propan-2-yl carbonate (PubChem CID 163875827) has the molecular formula C20H31N5O10P+ and a molecular weight of 532.47 g/mol. Its IUPAC name is [2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-(propan-2-yloxycarbonyloxymethoxy)oxaphosphiran-2-ium-3-yl]oxymethyl propan-2-yl carbonate.
| Compound Name | [2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-(propan-2-yloxycarbonyloxymethoxy)oxaphosphiran-2-ium-3-yl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 163875827 |
| Molecular Formula | C20H31N5O10P+ |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [2-[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl]-2-(propan-2-yloxycarbonyloxymethoxy)oxaphosphiran-2-ium-3-yl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOC1O[P+]1(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C20H31N5O10P/c1-12(2)33-18(26)28-9-30-20-35-36(20,32-10-29-19(27)34-13(3)4)11-31-14(5)6-25-8-24-15-16(21)22-7-23-17(15)25/h7-8,12-14,20H,6,9-11H2,1-5H3,(H2,21,22,23)/q+1/t14-,20?,36?/m1/s1 |
| InChIKey | IVFGSUITNTYSTD-FFECXGCJSA-N |
| XLogP | 3.00 |
| TPSA | 180.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|