C9H14N5O3P — CID 144949236
1-(6-aminopurin-9-yl)propan-2-yloxymethylphosphonous acid (PubChem CID 144949236) has the molecular formula C9H14N5O3P and a molecular weight of 271.22 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)propan-2-yloxymethylphosphonous acid.
| Compound Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethylphosphonous acid |
|---|---|
| PubChem CID | 144949236 |
| Molecular Formula | C9H14N5O3P |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethylphosphonous acid |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(O)O |
| InChI | InChI=1S/C9H14N5O3P/c1-6(17-5-18(15)16)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6,15-16H,2,5H2,1H3,(H2,10,11,12) |
| InChIKey | QANRSDWHZCPWPH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|