C23H34N5O16P — CID 118855450
[2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-1-[hydroxy(propan-2-yloxycarbonyloxymethoxy)phosphoryl]peroxyethyl] propan-2-yl carbonate;(E)-but-2-enedioic acid (PubChem CID 118855450) has the molecular formula C23H34N5O16P and a molecular weight of 667.52 g/mol. Its IUPAC name is [2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-1-[hydroxy(propan-2-yloxycarbonyloxymethoxy)phosphoryl]peroxyethyl] propan-2-yl carbonate;(E)-but-2-enedioic acid.
| Compound Name | [2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-1-[hydroxy(propan-2-yloxycarbonyloxymethoxy)phosphoryl]peroxyethyl] propan-2-yl carbonate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 118855450 |
| Molecular Formula | C23H34N5O16P |
| Molecular Weight | 667.52 g/mol |
| Exact Mass | 667.17 |
| IUPAC Name | [2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-1-[hydroxy(propan-2-yloxycarbonyloxymethoxy)phosphoryl]peroxyethyl] propan-2-yl carbonate;(E)-but-2-enedioic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)OOC(CO[C@H](C)Cn1cnc2c(N)ncnc21)OC(=O)OC(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H30N5O12P.C4H4O4/c1-11(2)32-18(25)30-10-31-37(27,28)36-35-14(34-19(26)33-12(3)4)7-29-13(5)6-24-9-23-15-16(20)21-8-22-17(15)24;5-3(6)1-2-4(7)8/h8-9,11-14H,6-7,10H2,1-5H3,(H,27,28)(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-,14?;/m1./s1 |
| InChIKey | PZEBKNDJJOXZQX-QBFJSAGBSA-N |
| XLogP | 2.00 |
| TPSA | 289.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|