C22H34N5O8P — CID 87454751
4-[[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid (PubChem CID 87454751) has the molecular formula C22H34N5O8P and a molecular weight of 527.52 g/mol. Its IUPAC name is 4-[[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87454751 |
| Molecular Formula | C22H34N5O8P |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 4-[[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(COC1(Cn2cnc3c(N)ncnc32)CC1)OCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C22H34N5O8P/c1-20(2,3)19(30)32-13-35-36(31,34-9-8-21(4,5)18(28)29)14-33-22(6-7-22)10-27-12-26-15-16(23)24-11-25-17(15)27/h11-12H,6-10,13-14H2,1-5H3,(H,28,29)(H2,23,24,25) |
| InChIKey | USVUHZHXZSZEEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|