C24H38N5O7P — CID 87454593
4-[2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]propyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid (PubChem CID 87454593) has the molecular formula C24H38N5O7P and a molecular weight of 539.57 g/mol. Its IUPAC name is 4-[2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]propyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]propyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87454593 |
| Molecular Formula | C24H38N5O7P |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 4-[2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]propyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxy-2,2-dimethylbutanoic acid |
| SMILES | CC(CP(=O)(OCCC(C)(C)C(=O)O)OCOC(=O)C(C)(C)C)C1(Cn2cnc3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C24H38N5O7P/c1-16(24(7-8-24)12-29-14-28-17-18(25)26-13-27-19(17)29)11-37(33,35-10-9-23(5,6)20(30)31)36-15-34-21(32)22(2,3)4/h13-14,16H,7-12,15H2,1-6H3,(H,30,31)(H2,25,26,27) |
| InChIKey | PMLYMURXIMAWFX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 168.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|