C19H30N5O6P — CID 173083075
[[1-[(6-aminopurin-9-yl)methyl]-2,2-dimethylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 173083075) has the molecular formula C19H30N5O6P and a molecular weight of 455.45 g/mol. Its IUPAC name is [[1-[(6-aminopurin-9-yl)methyl]-2,2-dimethylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[1-[(6-aminopurin-9-yl)methyl]-2,2-dimethylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173083075 |
| Molecular Formula | C19H30N5O6P |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [[1-[(6-aminopurin-9-yl)methyl]-2,2-dimethylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | COP(=O)(COC1(Cn2cnc3c(N)ncnc32)CC1(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30N5O6P/c1-17(2,3)16(25)28-11-30-31(26,27-6)12-29-19(7-18(19,4)5)8-24-10-23-13-14(20)21-9-22-15(13)24/h9-10H,7-8,11-12H2,1-6H3,(H2,20,21,22) |
| InChIKey | MCNOJKDGESNWRB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|