C16H26N5O6P — CID 87424362
(2R,3R,4S)-2-(6-aminopurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]oxolan-3-ol (PubChem CID 87424362) has the molecular formula C16H26N5O6P and a molecular weight of 415.39 g/mol. Its IUPAC name is (2R,3R,4S)-2-(6-aminopurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]oxolan-3-ol.
| Compound Name | (2R,3R,4S)-2-(6-aminopurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 87424362 |
| Molecular Formula | C16H26N5O6P |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2R,3R,4S)-2-(6-aminopurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]oxolan-3-ol |
| SMILES | CC(C)OP(=O)(CO[C@H]1CO[C@@H](n2cnc3c(N)ncnc32)[C@@H]1O)OC(C)C |
| InChI | InChI=1S/C16H26N5O6P/c1-9(2)26-28(23,27-10(3)4)8-25-11-5-24-16(13(11)22)21-7-20-12-14(17)18-6-19-15(12)21/h6-7,9-11,13,16,22H,5,8H2,1-4H3,(H2,17,18,19)/t11-,13+,16+/m0/s1 |
| InChIKey | SRBUTLKTRXWRSG-NORZTCDRSA-N |
| XLogP | 1.68 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|