C15H24N5O8P — CID 69266663
[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-(3-methylbutoxy)methyl] dihydrogen phosphate (PubChem CID 69266663) has the molecular formula C15H24N5O8P and a molecular weight of 433.36 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-(3-methylbutoxy)methyl] dihydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-(3-methylbutoxy)methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69266663 |
| Molecular Formula | C15H24N5O8P |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-(3-methylbutoxy)methyl] dihydrogen phosphate |
| SMILES | CC(C)CCOC(OP(=O)(O)O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24N5O8P/c1-7(2)3-4-26-15(28-29(23,24)25)11-9(21)10(22)14(27-11)20-6-19-8-12(16)17-5-18-13(8)20/h5-7,9-11,14-15,21-22H,3-4H2,1-2H3,(H2,16,17,18)(H2,23,24,25)/t9-,10+,11-,14+,15?/m0/s1 |
| InChIKey | MBTZVDDCMFFTHB-NDVLCCOJSA-N |
| XLogP | -0.47 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|