C10H16N5O10P2+ — CID 174086107
[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-phosphonooxyphosphanium (PubChem CID 174086107) has the molecular formula C10H16N5O10P2+ and a molecular weight of 428.21 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-phosphonooxyphosphanium.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-phosphonooxyphosphanium |
|---|---|
| PubChem CID | 174086107 |
| Molecular Formula | C10H16N5O10P2+ |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-dihydroxy-phosphonooxyphosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[P+](O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17,21-22H,1H2,(H3-,11,12,13,18,19,20)/p+1/t4-,6?,7?,10-/m1/s1 |
| InChIKey | XKIBEBDODPORCC-DGPXGRDGSA-O |
| XLogP | -2.18 |
| TPSA | 235.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|