C12H18N5O8P — CID 118472759
[(1S)-1-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid (PubChem CID 118472759) has the molecular formula C12H18N5O8P and a molecular weight of 391.28 g/mol. Its IUPAC name is [(1S)-1-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid.
| Compound Name | [(1S)-1-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 118472759 |
| Molecular Formula | C12H18N5O8P |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [(1S)-1-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-hydroxyethyl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[C@H](CO)P(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N5O8P/c13-10-7-11(15-3-14-10)17(4-16-7)12-9(20)8(19)5(25-12)2-24-6(1-18)26(21,22)23/h3-6,8-9,12,18-20H,1-2H2,(H2,13,14,15)(H2,21,22,23)/t5-,6+,8+,9-,12-/m1/s1 |
| InChIKey | LVEXHRCXENPGTK-MLVWDSLESA-N |
| XLogP | -2.46 |
| TPSA | 206.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|