C12H16N5Na2O8P — CID 51051213
disodium;(1R)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonatomethoxy)oxolan-2-yl]ethane-1,2-diol (PubChem CID 51051213) has the molecular formula C12H16N5Na2O8P and a molecular weight of 435.24 g/mol. Its IUPAC name is disodium;(1R)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonatomethoxy)oxolan-2-yl]ethane-1,2-diol.
| Compound Name | disodium;(1R)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonatomethoxy)oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 51051213 |
| Molecular Formula | C12H16N5Na2O8P |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | disodium;(1R)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonatomethoxy)oxolan-2-yl]ethane-1,2-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]([C@H](O)CO)[C@H](OCP(=O)([O-])[O-])[C@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C12H18N5O8P.2Na/c13-10-6-11(15-2-14-10)17(3-16-6)12-7(20)9(24-4-26(21,22)23)8(25-12)5(19)1-18;;/h2-3,5,7-9,12,18-20H,1,4H2,(H2,13,14,15)(H2,21,22,23);;/q;2*+1/p-2/t5-,7-,8+,9-,12-;;/m1../s1 |
| InChIKey | VXRLVZQYPWGLNJ-CYEONEDFSA-L |
| XLogP | -9.72 |
| TPSA | 211.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | -9.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|