About 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide
1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 176927591) has the molecular formula C16H23N5O
and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide |
| PubChem CID | 176927591 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)c1nc(C(C)C)c2ncn(CC3(C(N)=O)CC3)c2n1 |
| InChI | InChI=1S/C16H23N5O/c1-9(2)11-12-14(20-13(19-11)10(3)4)21(8-18-12)7-16(5-6-16)15(17)22/h8-10H,5-7H2,1-4H3,(H2,17,22) |
| InChIKey | PKLCPJZJEGZIJK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide?
The IUPAC name of 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide (CID 176927591) is 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide.
What is the SMILES notation for 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide?
The canonical SMILES for 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide is CC(C)c1nc(C(C)C)c2ncn(CC3(C(N)=O)CC3)c2n1.
What is the InChIKey of 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide?
The InChIKey is PKLCPJZJEGZIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O/c1-9(2)11-12-14(20-13(19-11)10(3)4)21(8-18-12)7-16(5-6-16)15(17)22/h8-10H,5-7H2,1-4H3,(H2,17,22).
What are the key properties of 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide?
1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide has a molecular weight of 301.39 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,6-di(propan-2-yl)purin-9-yl]methyl]cyclopropane-1-carboxamide is sourced from PubChem (CID 176927591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).