C16H21N5S — CID 176927861
4-[1-[2,6-di(propan-2-yl)purin-9-yl]ethyl]-1,2-thiazole (PubChem CID 176927861) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 4-[1-[2,6-di(propan-2-yl)purin-9-yl]ethyl]-1,2-thiazole.
| Compound Name | 4-[1-[2,6-di(propan-2-yl)purin-9-yl]ethyl]-1,2-thiazole |
|---|---|
| PubChem CID | 176927861 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-[1-[2,6-di(propan-2-yl)purin-9-yl]ethyl]-1,2-thiazole |
| SMILES | CC(C)c1nc(C(C)C)c2ncn(C(C)c3cnsc3)c2n1 |
| InChI | InChI=1S/C16H21N5S/c1-9(2)13-14-16(20-15(19-13)10(3)4)21(8-17-14)11(5)12-6-18-22-7-12/h6-11H,1-5H3 |
| InChIKey | DCNNLKJAZBGWKH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |