C17H28N4 — CID 176767202
2,6,8,9-tetra(propan-2-yl)purine (PubChem CID 176767202) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2,6,8,9-tetra(propan-2-yl)purine.
| Compound Name | 2,6,8,9-tetra(propan-2-yl)purine |
|---|---|
| PubChem CID | 176767202 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2,6,8,9-tetra(propan-2-yl)purine |
| SMILES | CC(C)c1nc(C(C)C)c2nc(C(C)C)n(C(C)C)c2n1 |
| InChI | InChI=1S/C17H28N4/c1-9(2)13-14-17(20-15(18-13)10(3)4)21(12(7)8)16(19-14)11(5)6/h9-12H,1-8H3 |
| InChIKey | SKTMSBWOJMCFMW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |