C15H22N4O — CID 176926702
9-(oxolan-2-yl)-2,6-di(propan-2-yl)purine (PubChem CID 176926702) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 9-(oxolan-2-yl)-2,6-di(propan-2-yl)purine.
| Compound Name | 9-(oxolan-2-yl)-2,6-di(propan-2-yl)purine |
|---|---|
| PubChem CID | 176926702 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 9-(oxolan-2-yl)-2,6-di(propan-2-yl)purine |
| SMILES | CC(C)c1nc(C(C)C)c2ncn(C3CCCO3)c2n1 |
| InChI | InChI=1S/C15H22N4O/c1-9(2)12-13-15(18-14(17-12)10(3)4)19(8-16-13)11-6-5-7-20-11/h8-11H,5-7H2,1-4H3 |
| InChIKey | MMUWRYWZVLGAIX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |