C14H21N5O2 — CID 135129621
N-methyl-9-(oxan-2-yl)-2-propan-2-yloxypurin-6-amine (PubChem CID 135129621) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is N-methyl-9-(oxan-2-yl)-2-propan-2-yloxypurin-6-amine.
| Compound Name | N-methyl-9-(oxan-2-yl)-2-propan-2-yloxypurin-6-amine |
|---|---|
| PubChem CID | 135129621 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-methyl-9-(oxan-2-yl)-2-propan-2-yloxypurin-6-amine |
| SMILES | CNc1nc(OC(C)C)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C14H21N5O2/c1-9(2)21-14-17-12(15-3)11-13(18-14)19(8-16-11)10-6-4-5-7-20-10/h8-10H,4-7H2,1-3H3,(H,15,17,18) |
| InChIKey | QQWXNIDKEQJWEJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |