C24H29F2N5O4 — CID 175342020
2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-N-[1-(oxan-4-yl)ethyl]purin-6-amine (PubChem CID 175342020) has the molecular formula C24H29F2N5O4 and a molecular weight of 489.52 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-N-[1-(oxan-4-yl)ethyl]purin-6-amine.
| Compound Name | 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-N-[1-(oxan-4-yl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 175342020 |
| Molecular Formula | C24H29F2N5O4 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-N-[1-(oxan-4-yl)ethyl]purin-6-amine |
| SMILES | COc1ccc(Oc2nc(NC(C)C3CCOCC3)c3ncn(C4CCCCO4)c3n2)c(F)c1F |
| InChI | InChI=1S/C24H29F2N5O4/c1-14(15-8-11-33-12-9-15)28-22-21-23(31(13-27-21)18-5-3-4-10-34-18)30-24(29-22)35-17-7-6-16(32-2)19(25)20(17)26/h6-7,13-15,18H,3-5,8-12H2,1-2H3,(H,28,29,30) |
| InChIKey | SHVHLHQVJYIIKH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |