C18H20IN5O3 — CID 146575045
N-(2,5-dimethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine (PubChem CID 146575045) has the molecular formula C18H20IN5O3 and a molecular weight of 481.29 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146575045 |
| Molecular Formula | C18H20IN5O3 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
| SMILES | COc1ccc(OC)c(Nc2nc(I)nc3c2ncn3C2CCCCO2)c1 |
| InChI | InChI=1S/C18H20IN5O3/c1-25-11-6-7-13(26-2)12(9-11)21-16-15-17(23-18(19)22-16)24(10-20-15)14-5-3-4-8-27-14/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,21,22,23) |
| InChIKey | PPDDYJRREKYDEC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|