C18H20IN5O2 — CID 146575249
N-(2-ethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine (PubChem CID 146575249) has the molecular formula C18H20IN5O2 and a molecular weight of 465.30 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-(2-ethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146575249 |
| Molecular Formula | C18H20IN5O2 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
| SMILES | CCOc1ccccc1Nc1nc(I)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C18H20IN5O2/c1-2-25-13-8-4-3-7-12(13)21-16-15-17(23-18(19)22-16)24(11-20-15)14-9-5-6-10-26-14/h3-4,7-8,11,14H,2,5-6,9-10H2,1H3,(H,21,22,23) |
| InChIKey | OFEQWKWEBFQCNP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|