C17H17BrIN5O2 — CID 146575136
N-(2-bromo-3-methoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine (PubChem CID 146575136) has the molecular formula C17H17BrIN5O2 and a molecular weight of 530.16 g/mol. Its IUPAC name is N-(2-bromo-3-methoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-(2-bromo-3-methoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146575136 |
| Molecular Formula | C17H17BrIN5O2 |
| Molecular Weight | 530.16 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | N-(2-bromo-3-methoxyphenyl)-2-iodo-9-(oxan-2-yl)purin-6-amine |
| SMILES | COc1cccc(Nc2nc(I)nc3c2ncn3C2CCCCO2)c1Br |
| InChI | InChI=1S/C17H17BrIN5O2/c1-25-11-6-4-5-10(13(11)18)21-15-14-16(23-17(19)22-15)24(9-20-14)12-7-2-3-8-26-12/h4-6,9,12H,2-3,7-8H2,1H3,(H,21,22,23) |
| InChIKey | KFSGLQRWSJTPSU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.16 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|