C17H18IN5O3 — CID 146574778
3-[[2-iodo-9-(oxan-2-yl)purin-6-yl]amino]-2-methoxyphenol (PubChem CID 146574778) has the molecular formula C17H18IN5O3 and a molecular weight of 467.27 g/mol. Its IUPAC name is 3-[[2-iodo-9-(oxan-2-yl)purin-6-yl]amino]-2-methoxyphenol.
| Compound Name | 3-[[2-iodo-9-(oxan-2-yl)purin-6-yl]amino]-2-methoxyphenol |
|---|---|
| PubChem CID | 146574778 |
| Molecular Formula | C17H18IN5O3 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-[[2-iodo-9-(oxan-2-yl)purin-6-yl]amino]-2-methoxyphenol |
| SMILES | COc1c(O)cccc1Nc1nc(I)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C17H18IN5O3/c1-25-14-10(5-4-6-11(14)24)20-15-13-16(22-17(18)21-15)23(9-19-13)12-7-2-3-8-26-12/h4-6,9,12,24H,2-3,7-8H2,1H3,(H,20,21,22) |
| InChIKey | KFUFJZQIMWCHNR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|