C17H20N6O3 — CID 146575033
6-N-(2,5-dimethoxyphenyl)-9-(oxolan-2-yl)purine-2,6-diamine (PubChem CID 146575033) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-N-(2,5-dimethoxyphenyl)-9-(oxolan-2-yl)purine-2,6-diamine.
| Compound Name | 6-N-(2,5-dimethoxyphenyl)-9-(oxolan-2-yl)purine-2,6-diamine |
|---|---|
| PubChem CID | 146575033 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6-N-(2,5-dimethoxyphenyl)-9-(oxolan-2-yl)purine-2,6-diamine |
| SMILES | COc1ccc(OC)c(Nc2nc(N)nc3c2ncn3C2CCCO2)c1 |
| InChI | InChI=1S/C17H20N6O3/c1-24-10-5-6-12(25-2)11(8-10)20-15-14-16(22-17(18)21-15)23(9-19-14)13-4-3-7-26-13/h5-6,8-9,13H,3-4,7H2,1-2H3,(H3,18,20,21,22) |
| InChIKey | HEZCEGJKSXIITM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |