C20H23F2N5O3 — CID 175036468
2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-8-propylpurin-6-amine (PubChem CID 175036468) has the molecular formula C20H23F2N5O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-8-propylpurin-6-amine.
| Compound Name | 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-8-propylpurin-6-amine |
|---|---|
| PubChem CID | 175036468 |
| Molecular Formula | C20H23F2N5O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-(2,3-difluoro-4-methoxyphenoxy)-9-(oxan-2-yl)-8-propylpurin-6-amine |
| SMILES | CCCc1nc2c(N)nc(Oc3ccc(OC)c(F)c3F)nc2n1C1CCCCO1 |
| InChI | InChI=1S/C20H23F2N5O3/c1-3-6-13-24-17-18(23)25-20(26-19(17)27(13)14-7-4-5-10-29-14)30-12-9-8-11(28-2)15(21)16(12)22/h8-9,14H,3-7,10H2,1-2H3,(H2,23,25,26) |
| InChIKey | HEVUXPJUQOZRNF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |