C13H18N6O3 — CID 102100714
[6-ethoxy-9-(oxan-2-yl)purin-2-yl]urea (PubChem CID 102100714) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is [6-ethoxy-9-(oxan-2-yl)purin-2-yl]urea.
| Compound Name | [6-ethoxy-9-(oxan-2-yl)purin-2-yl]urea |
|---|---|
| PubChem CID | 102100714 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [6-ethoxy-9-(oxan-2-yl)purin-2-yl]urea |
| SMILES | CCOc1nc(NC(N)=O)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C13H18N6O3/c1-2-21-11-9-10(16-13(17-11)18-12(14)20)19(7-15-9)8-5-3-4-6-22-8/h7-8H,2-6H2,1H3,(H3,14,16,17,18,20) |
| InChIKey | XHGLZMJVPMVSDO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |