C25H30N8O2 — CID 121464168
N-[6-ethoxy-9-(oxan-2-yl)purin-2-yl]-4-piperazin-1-ylquinolin-6-amine (PubChem CID 121464168) has the molecular formula C25H30N8O2 and a molecular weight of 474.57 g/mol. Its IUPAC name is N-[6-ethoxy-9-(oxan-2-yl)purin-2-yl]-4-piperazin-1-ylquinolin-6-amine.
| Compound Name | N-[6-ethoxy-9-(oxan-2-yl)purin-2-yl]-4-piperazin-1-ylquinolin-6-amine |
|---|---|
| PubChem CID | 121464168 |
| Molecular Formula | C25H30N8O2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[6-ethoxy-9-(oxan-2-yl)purin-2-yl]-4-piperazin-1-ylquinolin-6-amine |
| SMILES | CCOc1nc(Nc2ccc3nccc(N4CCNCC4)c3c2)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C25H30N8O2/c1-2-34-24-22-23(33(16-28-22)21-5-3-4-14-35-21)30-25(31-24)29-17-6-7-19-18(15-17)20(8-9-27-19)32-12-10-26-11-13-32/h6-9,15-16,21,26H,2-5,10-14H2,1H3,(H,29,30,31) |
| InChIKey | SJFNRJWAUXRJPU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |