C24H25N7O5S — CID 175251273
[3-[9-(oxan-2-yl)-2-(4-sulfamoylanilino)purin-6-yl]phenyl]methyl carbamate (PubChem CID 175251273) has the molecular formula C24H25N7O5S and a molecular weight of 523.58 g/mol. Its IUPAC name is [3-[9-(oxan-2-yl)-2-(4-sulfamoylanilino)purin-6-yl]phenyl]methyl carbamate.
| Compound Name | [3-[9-(oxan-2-yl)-2-(4-sulfamoylanilino)purin-6-yl]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175251273 |
| Molecular Formula | C24H25N7O5S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | [3-[9-(oxan-2-yl)-2-(4-sulfamoylanilino)purin-6-yl]phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1cccc(-c2nc(Nc3ccc(S(N)(=O)=O)cc3)nc3c2ncn3C2CCCCO2)c1 |
| InChI | InChI=1S/C24H25N7O5S/c25-23(32)36-13-15-4-3-5-16(12-15)20-21-22(31(14-27-21)19-6-1-2-11-35-19)30-24(29-20)28-17-7-9-18(10-8-17)37(26,33)34/h3-5,7-10,12,14,19H,1-2,6,11,13H2,(H2,25,32)(H2,26,33,34)(H,28,29,30) |
| InChIKey | OHWMOVWWKOWIAU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 177.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |