C35H37F2N7O — CID 118420771
6-N,6-N-dibenzyl-2-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-9-(oxan-2-yl)purine-2,6-diamine (PubChem CID 118420771) has the molecular formula C35H37F2N7O and a molecular weight of 609.73 g/mol. Its IUPAC name is 6-N,6-N-dibenzyl-2-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-9-(oxan-2-yl)purine-2,6-diamine.
| Compound Name | 6-N,6-N-dibenzyl-2-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-9-(oxan-2-yl)purine-2,6-diamine |
|---|---|
| PubChem CID | 118420771 |
| Molecular Formula | C35H37F2N7O |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | 6-N,6-N-dibenzyl-2-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-9-(oxan-2-yl)purine-2,6-diamine |
| SMILES | FC1(F)CCN(c2ccc(Nc3nc(N(Cc4ccccc4)Cc4ccccc4)c4ncn(C5CCCCO5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C35H37F2N7O/c36-35(37)18-20-42(21-19-35)29-16-14-28(15-17-29)39-34-40-32(31-33(41-34)44(25-38-31)30-13-7-8-22-45-30)43(23-26-9-3-1-4-10-26)24-27-11-5-2-6-12-27/h1-6,9-12,14-17,25,30H,7-8,13,18-24H2,(H,39,40,41) |
| InChIKey | SGDDCPOBVVAHQJ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|