C36H35N9O2 — CID 118426285
6-N,6-N-dibenzyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-(3-nitrophenyl)purine-2,6-diamine (PubChem CID 118426285) has the molecular formula C36H35N9O2 and a molecular weight of 625.74 g/mol. Its IUPAC name is 6-N,6-N-dibenzyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-(3-nitrophenyl)purine-2,6-diamine.
| Compound Name | 6-N,6-N-dibenzyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-(3-nitrophenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 118426285 |
| Molecular Formula | C36H35N9O2 |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | 6-N,6-N-dibenzyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-(3-nitrophenyl)purine-2,6-diamine |
| SMILES | CN1CCN(c2ccc(Nc3nc(N(Cc4ccccc4)Cc4ccccc4)c4ncn(-c5cccc([N+](=O)[O-])c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C36H35N9O2/c1-41-19-21-42(22-20-41)30-17-15-29(16-18-30)38-36-39-34(43(24-27-9-4-2-5-10-27)25-28-11-6-3-7-12-28)33-35(40-36)44(26-37-33)31-13-8-14-32(23-31)45(46)47/h2-18,23,26H,19-22,24-25H2,1H3,(H,38,39,40) |
| InChIKey | QXFPTAXMXHUUMB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|