C38H34F2N8O2 — CID 118426308
N-[3-[6-(dibenzylamino)-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide (PubChem CID 118426308) has the molecular formula C38H34F2N8O2 and a molecular weight of 672.74 g/mol. Its IUPAC name is N-[3-[6-(dibenzylamino)-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-(dibenzylamino)-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118426308 |
| Molecular Formula | C38H34F2N8O2 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | N-[3-[6-(dibenzylamino)-2-(3,5-difluoro-4-morpholin-4-ylanilino)purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4cc(F)c(N5CCOCC5)c(F)c4)nc32)c1 |
| InChI | InChI=1S/C38H34F2N8O2/c1-2-33(49)42-28-14-9-15-30(20-28)48-25-41-34-36(47(23-26-10-5-3-6-11-26)24-27-12-7-4-8-13-27)44-38(45-37(34)48)43-29-21-31(39)35(32(40)22-29)46-16-18-50-19-17-46/h2-15,20-22,25H,1,16-19,23-24H2,(H,42,49)(H,43,44,45) |
| InChIKey | XZEMBMCXVPLAAF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|