C34H27F2N7O — CID 118420642
N-[3-[6-(dibenzylamino)-2-(4-fluoroanilino)purin-9-yl]phenyl]-2-fluoroprop-2-enamide (PubChem CID 118420642) has the molecular formula C34H27F2N7O and a molecular weight of 587.63 g/mol. Its IUPAC name is N-[3-[6-(dibenzylamino)-2-(4-fluoroanilino)purin-9-yl]phenyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[3-[6-(dibenzylamino)-2-(4-fluoroanilino)purin-9-yl]phenyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 118420642 |
| Molecular Formula | C34H27F2N7O |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | N-[3-[6-(dibenzylamino)-2-(4-fluoroanilino)purin-9-yl]phenyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4ccc(F)cc4)nc32)c1 |
| InChI | InChI=1S/C34H27F2N7O/c1-23(35)33(44)38-28-13-8-14-29(19-28)43-22-37-30-31(40-34(41-32(30)43)39-27-17-15-26(36)16-18-27)42(20-24-9-4-2-5-10-24)21-25-11-6-3-7-12-25/h2-19,22H,1,20-21H2,(H,38,44)(H,39,40,41) |
| InChIKey | CZYDUXHEMMLKSL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|