C32H26F3N7O — CID 118420629
9-(3-aminophenyl)-6-N,6-N-dibenzyl-2-N-[4-(trifluoromethoxy)phenyl]purine-2,6-diamine (PubChem CID 118420629) has the molecular formula C32H26F3N7O and a molecular weight of 581.60 g/mol. Its IUPAC name is 9-(3-aminophenyl)-6-N,6-N-dibenzyl-2-N-[4-(trifluoromethoxy)phenyl]purine-2,6-diamine.
| Compound Name | 9-(3-aminophenyl)-6-N,6-N-dibenzyl-2-N-[4-(trifluoromethoxy)phenyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 118420629 |
| Molecular Formula | C32H26F3N7O |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 9-(3-aminophenyl)-6-N,6-N-dibenzyl-2-N-[4-(trifluoromethoxy)phenyl]purine-2,6-diamine |
| SMILES | Nc1cccc(-n2cnc3c(N(Cc4ccccc4)Cc4ccccc4)nc(Nc4ccc(OC(F)(F)F)cc4)nc32)c1 |
| InChI | InChI=1S/C32H26F3N7O/c33-32(34,35)43-27-16-14-25(15-17-27)38-31-39-29(28-30(40-31)42(21-37-28)26-13-7-12-24(36)18-26)41(19-22-8-3-1-4-9-22)20-23-10-5-2-6-11-23/h1-18,21H,19-20,36H2,(H,38,39,40) |
| InChIKey | RXYDHSFMJLXCJF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|