C29H28N8 — CID 90388861
4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90388861) has the molecular formula C29H28N8 and a molecular weight of 488.60 g/mol. Its IUPAC name is 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90388861 |
| Molecular Formula | C29H28N8 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 4-N,6-N-bis(3-aminophenyl)-2-N,2-N-dibenzyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1cccc(Nc2nc(Nc3cccc(N)c3)nc(N(Cc3ccccc3)Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C29H28N8/c30-23-13-7-15-25(17-23)32-27-34-28(33-26-16-8-14-24(31)18-26)36-29(35-27)37(19-21-9-3-1-4-10-21)20-22-11-5-2-6-12-22/h1-18H,19-20,30-31H2,(H2,32,33,34,35,36) |
| InChIKey | DWLFXWUNMNPLOM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|