C22H23N9 — CID 11546096
2-N,4-N-bis(3-aminophenyl)-6-N-[(4-aminophenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 11546096) has the molecular formula C22H23N9 and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-N,4-N-bis(3-aminophenyl)-6-N-[(4-aminophenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(3-aminophenyl)-6-N-[(4-aminophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11546096 |
| Molecular Formula | C22H23N9 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-N,4-N-bis(3-aminophenyl)-6-N-[(4-aminophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1ccc(CNc2nc(Nc3cccc(N)c3)nc(Nc3cccc(N)c3)n2)cc1 |
| InChI | InChI=1S/C22H23N9/c23-15-9-7-14(8-10-15)13-26-20-29-21(27-18-5-1-3-16(24)11-18)31-22(30-20)28-19-6-2-4-17(25)12-19/h1-12H,13,23-25H2,(H3,26,27,28,29,30,31) |
| InChIKey | XJGCCLVZJYCUKK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|